C21H23NO5 — CID 9455619
[2-[4-(acetamidomethyl)phenyl]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate (PubChem CID 9455619) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is [2-[4-(acetamidomethyl)phenyl]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate.
| Compound Name | [2-[4-(acetamidomethyl)phenyl]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 9455619 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [2-[4-(acetamidomethyl)phenyl]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate |
| SMILES | COc1ccccc1CCC(=O)OCC(=O)c1ccc(CNC(C)=O)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-15(23)22-13-16-7-9-17(10-8-16)19(24)14-27-21(25)12-11-18-5-3-4-6-20(18)26-2/h3-10H,11-14H2,1-2H3,(H,22,23) |
| InChIKey | QBWJFWISZZCZQK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |