C21H24O6 — CID 55368789
[2-(4-ethoxyphenyl)-2-oxoethyl] 3-(2,3-dimethoxyphenyl)propanoate (PubChem CID 55368789) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 3-(2,3-dimethoxyphenyl)propanoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 3-(2,3-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 55368789 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 3-(2,3-dimethoxyphenyl)propanoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)CCc2cccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C21H24O6/c1-4-26-17-11-8-15(9-12-17)18(22)14-27-20(23)13-10-16-6-5-7-19(24-2)21(16)25-3/h5-9,11-12H,4,10,13-14H2,1-3H3 |
| InChIKey | ITNJBTOLWXCGNR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |