C18H16N2O6 — CID 2363987
[2-(furan-2-ylmethylamino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 2363987) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 2363987 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCC(=O)NCc1ccco1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H16N2O6/c1-11(20-16(22)13-6-2-3-7-14(13)17(20)23)18(24)26-10-15(21)19-9-12-5-4-8-25-12/h2-8,11H,9-10H2,1H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | GMJLOYRBZFTEAF-NSHDSACASA-N |
| XLogP | 1.12 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|