C16H11F3N2O4S — CID 8958449
[(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 4-(trifluoromethoxy)benzoate (PubChem CID 8958449) has the molecular formula C16H11F3N2O4S and a molecular weight of 384.34 g/mol. Its IUPAC name is [(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 4-(trifluoromethoxy)benzoate.
| Compound Name | [(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 8958449 |
| Molecular Formula | C16H11F3N2O4S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | [(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 4-(trifluoromethoxy)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(OC(F)(F)F)cc1)C(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C16H11F3N2O4S/c1-9(13(22)21-14-11(8-20)6-7-26-14)24-15(23)10-2-4-12(5-3-10)25-16(17,18)19/h2-7,9H,1H3,(H,21,22)/t9-/m1/s1 |
| InChIKey | AFQLMWMCOCMMSX-SECBINFHSA-N |
| XLogP | 3.70 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |