C13H8ClN3O3S — CID 8904958
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-chloropyridine-2-carboxylate (PubChem CID 8904958) has the molecular formula C13H8ClN3O3S and a molecular weight of 321.75 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-chloropyridine-2-carboxylate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-chloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 8904958 |
| Molecular Formula | C13H8ClN3O3S |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-chloropyridine-2-carboxylate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C13H8ClN3O3S/c14-9-1-3-16-10(5-9)13(19)20-7-11(18)17-12-8(6-15)2-4-21-12/h1-5H,7H2,(H,17,18) |
| InChIKey | LGSBNZCMTCOAJR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |