C16H19BrN2O4 — CID 8875986
[2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 3-bromo-4-methoxybenzoate (PubChem CID 8875986) has the molecular formula C16H19BrN2O4 and a molecular weight of 383.24 g/mol. Its IUPAC name is [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 3-bromo-4-methoxybenzoate.
| Compound Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 3-bromo-4-methoxybenzoate |
|---|---|
| PubChem CID | 8875986 |
| Molecular Formula | C16H19BrN2O4 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 3-bromo-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N[C@@](C)(C#N)C(C)C)cc1Br |
| InChI | InChI=1S/C16H19BrN2O4/c1-10(2)16(3,9-18)19-14(20)8-23-15(21)11-5-6-13(22-4)12(17)7-11/h5-7,10H,8H2,1-4H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | XMMHXAGBZVSXBK-INIZCTEOSA-N |
| XLogP | 2.67 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |