C39H30Br2N2O5 — CID 4180086
[2-oxo-2-(4-phenylphenyl)ethyl] 2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 4180086) has the molecular formula C39H30Br2N2O5 and a molecular weight of 766.49 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4180086 |
| Molecular Formula | C39H30Br2N2O5 |
| Molecular Weight | 766.49 g/mol |
| Exact Mass | 764.05 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | Cc1cccc2c(C(=O)OCC(=O)c3ccc(-c4ccccc4)cc3)cc(-c3ccc(N4C(=O)C5CC(Br)C(Br)CC5C4=O)cc3)nc12 |
| InChI | InChI=1S/C39H30Br2N2O5/c1-22-6-5-9-28-31(39(47)48-21-35(44)26-12-10-24(11-13-26)23-7-3-2-4-8-23)20-34(42-36(22)28)25-14-16-27(17-15-25)43-37(45)29-18-32(40)33(41)19-30(29)38(43)46/h2-17,20,29-30,32-33H,18-19,21H2,1H3 |
| InChIKey | GJZSXEWUJSVDKZ-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.49 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|