C31H26N2O5S — CID 3339397
(2-oxo-2-thiophen-2-ylethyl) 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 3339397) has the molecular formula C31H26N2O5S and a molecular weight of 538.63 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3339397 |
| Molecular Formula | C31H26N2O5S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | Cc1cccc2c(C(=O)OCC(=O)c3cccs3)cc(-c3ccc(N4C(=O)C5CCCCC5C4=O)cc3)nc12 |
| InChI | InChI=1S/C31H26N2O5S/c1-18-6-4-9-21-24(31(37)38-17-26(34)27-10-5-15-39-27)16-25(32-28(18)21)19-11-13-20(14-12-19)33-29(35)22-7-2-3-8-23(22)30(33)36/h4-6,9-16,22-23H,2-3,7-8,17H2,1H3 |
| InChIKey | VOXBDJWJQZYVRG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|