C33H25BrN2O5S — CID 4105026
(2-oxo-2-thiophen-2-ylethyl) 6-bromo-8-methyl-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4105026) has the molecular formula C33H25BrN2O5S and a molecular weight of 641.54 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 6-bromo-8-methyl-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 6-bromo-8-methyl-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4105026 |
| Molecular Formula | C33H25BrN2O5S |
| Molecular Weight | 641.54 g/mol |
| Exact Mass | 640.07 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 6-bromo-8-methyl-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CC1=CC2CC1C1C(=O)N(c3ccc(-c4cc(C(=O)OCC(=O)c5cccs5)c5cc(Br)cc(C)c5n4)cc3)C(=O)C21 |
| InChI | InChI=1S/C33H25BrN2O5S/c1-16-10-19-12-22(16)29-28(19)31(38)36(32(29)39)21-7-5-18(6-8-21)25-14-24(23-13-20(34)11-17(2)30(23)35-25)33(40)41-15-26(37)27-4-3-9-42-27/h3-11,13-14,19,22,28-29H,12,15H2,1-2H3 |
| InChIKey | UWKPKYPGPRVPSJ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|