C37H27Cl3N2O5 — CID 5059248
[4-chloro-1-(4-chlorophenyl)-1-oxobutan-2-yl] 6-chloro-2-[4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)phenyl]quinoline-4-carboxylate (PubChem CID 5059248) has the molecular formula C37H27Cl3N2O5 and a molecular weight of 685.99 g/mol. Its IUPAC name is [4-chloro-1-(4-chlorophenyl)-1-oxobutan-2-yl] 6-chloro-2-[4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [4-chloro-1-(4-chlorophenyl)-1-oxobutan-2-yl] 6-chloro-2-[4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 5059248 |
| Molecular Formula | C37H27Cl3N2O5 |
| Molecular Weight | 685.99 g/mol |
| Exact Mass | 684.10 |
| IUPAC Name | [4-chloro-1-(4-chlorophenyl)-1-oxobutan-2-yl] 6-chloro-2-[4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)phenyl]quinoline-4-carboxylate |
| SMILES | O=C(OC(CCCl)C(=O)c1ccc(Cl)cc1)c1cc(-c2ccc(N3C(=O)C4C5C=CC(C6CC56)C4C3=O)cc2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C37H27Cl3N2O5/c38-14-13-31(34(43)19-1-5-20(39)6-2-19)47-37(46)28-17-30(41-29-12-7-21(40)15-27(28)29)18-3-8-22(9-4-18)42-35(44)32-23-10-11-24(26-16-25(23)26)33(32)36(42)45/h1-12,15,17,23-26,31-33H,13-14,16H2 |
| InChIKey | VYSVOQDWZBYMEH-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.99 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|