C38H32N2O5 — CID 3441654
(1-oxo-1-phenylbutan-2-yl) 2-[4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 3441654) has the molecular formula C38H32N2O5 and a molecular weight of 596.68 g/mol. Its IUPAC name is (1-oxo-1-phenylbutan-2-yl) 2-[4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylbutan-2-yl) 2-[4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3441654 |
| Molecular Formula | C38H32N2O5 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | (1-oxo-1-phenylbutan-2-yl) 2-[4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | CCC(OC(=O)c1cc(-c2ccc(N3C(=O)C4C5C=CC(C6CC56)C4C3=O)cc2)nc2c(C)cccc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C38H32N2O5/c1-3-31(35(41)22-9-5-4-6-10-22)45-38(44)29-19-30(39-34-20(2)8-7-11-26(29)34)21-12-14-23(15-13-21)40-36(42)32-24-16-17-25(28-18-27(24)28)33(32)37(40)43/h4-17,19,24-25,27-28,31-33H,3,18H2,1-2H3 |
| InChIKey | SEVNEUQJJQYPMR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|