C22H22N2O2 — CID 16643746
6-methyl-2-(4-methylphenyl)-3-pyrrolidin-1-ylquinoline-4-carboxylic acid (PubChem CID 16643746) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 6-methyl-2-(4-methylphenyl)-3-pyrrolidin-1-ylquinoline-4-carboxylic acid.
| Compound Name | 6-methyl-2-(4-methylphenyl)-3-pyrrolidin-1-ylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 16643746 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 6-methyl-2-(4-methylphenyl)-3-pyrrolidin-1-ylquinoline-4-carboxylic acid |
| SMILES | Cc1ccc(-c2nc3ccc(C)cc3c(C(=O)O)c2N2CCCC2)cc1 |
| InChI | InChI=1S/C22H22N2O2/c1-14-5-8-16(9-6-14)20-21(24-11-3-4-12-24)19(22(25)26)17-13-15(2)7-10-18(17)23-20/h5-10,13H,3-4,11-12H2,1-2H3,(H,25,26) |
| InChIKey | DJEUHNSYBAQNJD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |