C21H21NO3 — CID 5113292
3,6-dimethyl-2-(4-propoxyphenyl)quinoline-4-carboxylic acid (PubChem CID 5113292) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 3,6-dimethyl-2-(4-propoxyphenyl)quinoline-4-carboxylic acid.
| Compound Name | 3,6-dimethyl-2-(4-propoxyphenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 5113292 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3,6-dimethyl-2-(4-propoxyphenyl)quinoline-4-carboxylic acid |
| SMILES | CCCOc1ccc(-c2nc3ccc(C)cc3c(C(=O)O)c2C)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-4-11-25-16-8-6-15(7-9-16)20-14(3)19(21(23)24)17-12-13(2)5-10-18(17)22-20/h5-10,12H,4,11H2,1-3H3,(H,23,24) |
| InChIKey | HBNOUDVKMPXCOM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |