C26H19BrClNO3 — CID 3836640
[1-(4-methylphenyl)-1-oxopropan-2-yl] 6-bromo-2-(4-chlorophenyl)quinoline-4-carboxylate (PubChem CID 3836640) has the molecular formula C26H19BrClNO3 and a molecular weight of 508.80 g/mol. Its IUPAC name is [1-(4-methylphenyl)-1-oxopropan-2-yl] 6-bromo-2-(4-chlorophenyl)quinoline-4-carboxylate.
| Compound Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 6-bromo-2-(4-chlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3836640 |
| Molecular Formula | C26H19BrClNO3 |
| Molecular Weight | 508.80 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 6-bromo-2-(4-chlorophenyl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(C(=O)C(C)OC(=O)c2cc(-c3ccc(Cl)cc3)nc3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C26H19BrClNO3/c1-15-3-5-18(6-4-15)25(30)16(2)32-26(31)22-14-24(17-7-10-20(28)11-8-17)29-23-12-9-19(27)13-21(22)23/h3-14,16H,1-2H3 |
| InChIKey | UETYAVLYHRYSNY-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.80 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |