C35H27BrN2O5 — CID 4067443
(1-oxo-1-phenylpropan-2-yl) 6-bromo-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4067443) has the molecular formula C35H27BrN2O5 and a molecular weight of 635.51 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 6-bromo-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 6-bromo-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4067443 |
| Molecular Formula | C35H27BrN2O5 |
| Molecular Weight | 635.51 g/mol |
| Exact Mass | 634.11 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 6-bromo-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CC1=CC2CC1C1C(=O)N(c3ccc(-c4cc(C(=O)OC(C)C(=O)c5ccccc5)c5cc(Br)ccc5n4)cc3)C(=O)C21 |
| InChI | InChI=1S/C35H27BrN2O5/c1-18-14-22-15-25(18)31-30(22)33(40)38(34(31)41)24-11-8-20(9-12-24)29-17-27(26-16-23(36)10-13-28(26)37-29)35(42)43-19(2)32(39)21-6-4-3-5-7-21/h3-14,16-17,19,22,25,30-31H,15H2,1-2H3 |
| InChIKey | ZVILPZRJWPPDNZ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.51 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|