C36H30BrClN2O5 — CID 4112424
[1-(3-chlorophenyl)-1-oxopropan-2-yl] 6-bromo-8-ethyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4112424) has the molecular formula C36H30BrClN2O5 and a molecular weight of 686.00 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-1-oxopropan-2-yl] 6-bromo-8-ethyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [1-(3-chlorophenyl)-1-oxopropan-2-yl] 6-bromo-8-ethyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4112424 |
| Molecular Formula | C36H30BrClN2O5 |
| Molecular Weight | 686.00 g/mol |
| Exact Mass | 684.10 |
| IUPAC Name | [1-(3-chlorophenyl)-1-oxopropan-2-yl] 6-bromo-8-ethyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CCc1cc(Br)cc2c(C(=O)OC(C)C(=O)c3cccc(Cl)c3)cc(-c3ccc(N4C(=O)C5CC=CC(C)C5C4=O)cc3)nc12 |
| InChI | InChI=1S/C36H30BrClN2O5/c1-4-21-15-24(37)17-28-29(36(44)45-20(3)33(41)23-8-6-9-25(38)16-23)18-30(39-32(21)28)22-11-13-26(14-12-22)40-34(42)27-10-5-7-19(2)31(27)35(40)43/h5-9,11-20,27,31H,4,10H2,1-3H3 |
| InChIKey | RPIWQXMQMLAWGT-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.00 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|