C36H28Br3ClN2O5 — CID 3648256
[1-(3-chlorophenyl)-1-oxopropan-2-yl] 6-bromo-2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-ethylquinoline-4-carboxylate (PubChem CID 3648256) has the molecular formula C36H28Br3ClN2O5 and a molecular weight of 843.79 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-1-oxopropan-2-yl] 6-bromo-2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-ethylquinoline-4-carboxylate.
| Compound Name | [1-(3-chlorophenyl)-1-oxopropan-2-yl] 6-bromo-2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-ethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3648256 |
| Molecular Formula | C36H28Br3ClN2O5 |
| Molecular Weight | 843.79 g/mol |
| Exact Mass | 839.92 |
| IUPAC Name | [1-(3-chlorophenyl)-1-oxopropan-2-yl] 6-bromo-2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-ethylquinoline-4-carboxylate |
| SMILES | CCc1cc(Br)cc2c(C(=O)OC(C)C(=O)c3cccc(Cl)c3)cc(-c3ccc(N4C(=O)C5C6CC(C(Br)C6Br)C5C4=O)cc3)nc12 |
| InChI | InChI=1S/C36H28Br3ClN2O5/c1-3-17-11-20(37)13-23-24(36(46)47-16(2)33(43)19-5-4-6-21(40)12-19)15-27(41-32(17)23)18-7-9-22(10-8-18)42-34(44)28-25-14-26(29(28)35(42)45)31(39)30(25)38/h4-13,15-16,25-26,28-31H,3,14H2,1-2H3 |
| InChIKey | YRYXRLGJQWNWIZ-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.79 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|