C34H25Br3Cl2N2O5 — CID 5108463
[1-(3-chlorophenyl)-1-oxopropan-2-yl] 6-bromo-7-chloro-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 5108463) has the molecular formula C34H25Br3Cl2N2O5 and a molecular weight of 852.20 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-1-oxopropan-2-yl] 6-bromo-7-chloro-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | [1-(3-chlorophenyl)-1-oxopropan-2-yl] 6-bromo-7-chloro-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 5108463 |
| Molecular Formula | C34H25Br3Cl2N2O5 |
| Molecular Weight | 852.20 g/mol |
| Exact Mass | 847.87 |
| IUPAC Name | [1-(3-chlorophenyl)-1-oxopropan-2-yl] 6-bromo-7-chloro-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | Cc1c(Cl)c(Br)cc2c(C(=O)OC(C)C(=O)c3cccc(Cl)c3)cc(-c3ccc(N4C(=O)C5CC(Br)C(Br)CC5C4=O)cc3)nc12 |
| InChI | InChI=1S/C34H25Br3Cl2N2O5/c1-15-29(39)27(37)11-21-24(34(45)46-16(2)31(42)18-4-3-5-19(38)10-18)14-28(40-30(15)21)17-6-8-20(9-7-17)41-32(43)22-12-25(35)26(36)13-23(22)33(41)44/h3-11,14,16,22-23,25-26H,12-13H2,1-2H3 |
| InChIKey | VCIPUDCJYVILGK-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.20 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|