C34H27ClN2O5 — CID 21175986
[(2R)-1-(3-chlorophenyl)-1-oxopropan-2-yl] 2-[3-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]quinoline-4-carboxylate (PubChem CID 21175986) has the molecular formula C34H27ClN2O5 and a molecular weight of 579.05 g/mol. Its IUPAC name is [(2R)-1-(3-chlorophenyl)-1-oxopropan-2-yl] 2-[3-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]quinoline-4-carboxylate.
| Compound Name | [(2R)-1-(3-chlorophenyl)-1-oxopropan-2-yl] 2-[3-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 21175986 |
| Molecular Formula | C34H27ClN2O5 |
| Molecular Weight | 579.05 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | [(2R)-1-(3-chlorophenyl)-1-oxopropan-2-yl] 2-[3-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]quinoline-4-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cc(-c2cccc(N3C(=O)[C@H]4[C@@H]5CC[C@H](C5)[C@@H]4C3=O)c2)nc2ccccc12)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C34H27ClN2O5/c1-18(31(38)22-7-4-8-23(35)15-22)42-34(41)26-17-28(36-27-11-3-2-10-25(26)27)19-6-5-9-24(16-19)37-32(39)29-20-12-13-21(14-20)30(29)33(37)40/h2-11,15-18,20-21,29-30H,12-14H2,1H3/t18-,20-,21-,29+,30+/m1/s1 |
| InChIKey | DJUODLNFXIHAQT-WHDWBPJQSA-N |
| XLogP | 6.52 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.05 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|