C24H24FNO5 — CID 98185498
[2-(4-fluorophenyl)-2-oxoethyl] 4-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]cyclohexane-1-carboxylate (PubChem CID 98185498) has the molecular formula C24H24FNO5 and a molecular weight of 425.46 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 4-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]cyclohexane-1-carboxylate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 98185498 |
| Molecular Formula | C24H24FNO5 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]cyclohexane-1-carboxylate |
| SMILES | O=C(COC(=O)C1CCC(N2C(=O)[C@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H24FNO5/c25-17-7-3-13(4-8-17)19(27)12-31-24(30)14-5-9-18(10-6-14)26-22(28)20-15-1-2-16(11-15)21(20)23(26)29/h1-4,7-8,14-16,18,20-21H,5-6,9-12H2/t14?,15-,16-,18?,20+,21+/m0/s1 |
| InChIKey | RGEOKAQTMSWIIU-ROMQECONSA-N |
| XLogP | 2.92 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|