C21H21NO4 — CID 67316336
2-[2-[3-(cyclobutylmethoxy)phenoxy]ethyl]isoindole-1,3-dione (PubChem CID 67316336) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[2-[3-(cyclobutylmethoxy)phenoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[3-(cyclobutylmethoxy)phenoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67316336 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-[2-[3-(cyclobutylmethoxy)phenoxy]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCOc1cccc(OCC2CCC2)c1 |
| InChI | InChI=1S/C21H21NO4/c23-20-18-9-1-2-10-19(18)21(24)22(20)11-12-25-16-7-4-8-17(13-16)26-14-15-5-3-6-15/h1-2,4,7-10,13,15H,3,5-6,11-12,14H2 |
| InChIKey | LSMOAORCZCAGQU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|