C24H27NO4 — CID 67316448
2-[3-[3-[[(1R,2S)-2-hydroxycyclohexyl]methoxy]phenyl]propyl]isoindole-1,3-dione (PubChem CID 67316448) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-[3-[3-[[(1R,2S)-2-hydroxycyclohexyl]methoxy]phenyl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[3-[[(1R,2S)-2-hydroxycyclohexyl]methoxy]phenyl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67316448 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-[3-[3-[[(1R,2S)-2-hydroxycyclohexyl]methoxy]phenyl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCc1cccc(OC[C@H]2CCCC[C@@H]2O)c1 |
| InChI | InChI=1S/C24H27NO4/c26-22-13-4-1-9-18(22)16-29-19-10-5-7-17(15-19)8-6-14-25-23(27)20-11-2-3-12-21(20)24(25)28/h2-3,5,7,10-12,15,18,22,26H,1,4,6,8-9,13-14,16H2/t18-,22+/m1/s1 |
| InChIKey | JERQENCVBBGVLT-GCJKJVERSA-N |
| XLogP | 3.85 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|