C24H26F2N2O2 — CID 67296749
2-[3-[3-[(4,4-difluorocyclohexyl)methylamino]phenyl]propyl]isoindole-1,3-dione (PubChem CID 67296749) has the molecular formula C24H26F2N2O2 and a molecular weight of 412.48 g/mol. Its IUPAC name is 2-[3-[3-[(4,4-difluorocyclohexyl)methylamino]phenyl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[3-[(4,4-difluorocyclohexyl)methylamino]phenyl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67296749 |
| Molecular Formula | C24H26F2N2O2 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[3-[3-[(4,4-difluorocyclohexyl)methylamino]phenyl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCc1cccc(NCC2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C24H26F2N2O2/c25-24(26)12-10-18(11-13-24)16-27-19-7-3-5-17(15-19)6-4-14-28-22(29)20-8-1-2-9-21(20)23(28)30/h1-3,5,7-9,15,18,27H,4,6,10-14,16H2 |
| InChIKey | IQPRXLMUTRGYDG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|