C27H28O4Si — CID 162926023
4-hydroxy-3-prop-2-enyl-6-(triphenylsilyloxymethyl)oxan-2-one (PubChem CID 162926023) has the molecular formula C27H28O4Si and a molecular weight of 444.60 g/mol. Its IUPAC name is 4-hydroxy-3-prop-2-enyl-6-(triphenylsilyloxymethyl)oxan-2-one.
| Compound Name | 4-hydroxy-3-prop-2-enyl-6-(triphenylsilyloxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 162926023 |
| Molecular Formula | C27H28O4Si |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 4-hydroxy-3-prop-2-enyl-6-(triphenylsilyloxymethyl)oxan-2-one |
| SMILES | C=CCC1C(=O)OC(CO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)CC1O |
| InChI | InChI=1S/C27H28O4Si/c1-2-12-25-26(28)19-21(31-27(25)29)20-30-32(22-13-6-3-7-14-22,23-15-8-4-9-16-23)24-17-10-5-11-18-24/h2-11,13-18,21,25-26,28H,1,12,19-20H2 |
| InChIKey | DRKBKMXGRPKDIP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|