C42H36O4Si2 — CID 100953437
(2R,3S)-3-triphenylsilyloxy-2-(triphenylsilyloxymethyl)-2,3-dihydropyran-6-one (PubChem CID 100953437) has the molecular formula C42H36O4Si2 and a molecular weight of 660.92 g/mol. Its IUPAC name is (2R,3S)-3-triphenylsilyloxy-2-(triphenylsilyloxymethyl)-2,3-dihydropyran-6-one.
| Compound Name | (2R,3S)-3-triphenylsilyloxy-2-(triphenylsilyloxymethyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 100953437 |
| Molecular Formula | C42H36O4Si2 |
| Molecular Weight | 660.92 g/mol |
| Exact Mass | 660.22 |
| IUPAC Name | (2R,3S)-3-triphenylsilyloxy-2-(triphenylsilyloxymethyl)-2,3-dihydropyran-6-one |
| SMILES | O=C1C=C[C@H](O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C42H36O4Si2/c43-42-32-31-40(46-48(37-25-13-4-14-26-37,38-27-15-5-16-28-38)39-29-17-6-18-30-39)41(45-42)33-44-47(34-19-7-1-8-20-34,35-21-9-2-10-22-35)36-23-11-3-12-24-36/h1-32,40-41H,33H2/t40-,41+/m0/s1 |
| InChIKey | OLVPBROGNMQKIR-WVILEFPPSA-N |
| XLogP | 4.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.92 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|