C10H16O3 — CID 142893830
(5R)-4-hydroxy-5-propan-2-yl-3-prop-2-enyloxolan-2-one (PubChem CID 142893830) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (5R)-4-hydroxy-5-propan-2-yl-3-prop-2-enyloxolan-2-one.
| Compound Name | (5R)-4-hydroxy-5-propan-2-yl-3-prop-2-enyloxolan-2-one |
|---|---|
| PubChem CID | 142893830 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (5R)-4-hydroxy-5-propan-2-yl-3-prop-2-enyloxolan-2-one |
| SMILES | C=CCC1C(=O)O[C@H](C(C)C)C1O |
| InChI | InChI=1S/C10H16O3/c1-4-5-7-8(11)9(6(2)3)13-10(7)12/h4,6-9,11H,1,5H2,2-3H3/t7?,8?,9-/m1/s1 |
| InChIKey | GAOUPTFDAZXVSA-AMDVSUOASA-N |
| XLogP | 1.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|