C33H38N2O3Si — CID 67980463
5-[[(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-phenylcyclopropyl]methoxy]-2,6-dimethylpyridazin-3-one (PubChem CID 67980463) has the molecular formula C33H38N2O3Si and a molecular weight of 538.76 g/mol. Its IUPAC name is 5-[[(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-phenylcyclopropyl]methoxy]-2,6-dimethylpyridazin-3-one.
| Compound Name | 5-[[(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-phenylcyclopropyl]methoxy]-2,6-dimethylpyridazin-3-one |
|---|---|
| PubChem CID | 67980463 |
| Molecular Formula | C33H38N2O3Si |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 5-[[(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-phenylcyclopropyl]methoxy]-2,6-dimethylpyridazin-3-one |
| SMILES | Cc1nn(C)c(=O)cc1OC[C@@]1(c2ccccc2)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H38N2O3Si/c1-25-30(21-31(36)35(5)34-25)37-24-33(26-15-9-6-10-16-26)22-27(33)23-38-39(32(2,3)4,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h6-21,27H,22-24H2,1-5H3/t27-,33+/m0/s1 |
| InChIKey | CZORHFYBZUFMPH-VCTRWQRLSA-N |
| XLogP | 5.00 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|