C32H44O2Si2 — CID 102371411
tert-butyl-[[(1S,2S,4R)-4-(methoxymethyl)-2-methyl-4-phenylcyclopentyl]-dimethylsilyl]oxy-diphenylsilane (PubChem CID 102371411) has the molecular formula C32H44O2Si2 and a molecular weight of 516.87 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,4R)-4-(methoxymethyl)-2-methyl-4-phenylcyclopentyl]-dimethylsilyl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[[(1S,2S,4R)-4-(methoxymethyl)-2-methyl-4-phenylcyclopentyl]-dimethylsilyl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 102371411 |
| Molecular Formula | C32H44O2Si2 |
| Molecular Weight | 516.87 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | tert-butyl-[[(1S,2S,4R)-4-(methoxymethyl)-2-methyl-4-phenylcyclopentyl]-dimethylsilyl]oxy-diphenylsilane |
| SMILES | COC[C@]1(c2ccccc2)C[C@H](C)[C@@H]([Si](C)(C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C32H44O2Si2/c1-26-23-32(25-33-5,27-17-11-8-12-18-27)24-30(26)35(6,7)34-36(31(2,3)4,28-19-13-9-14-20-28)29-21-15-10-16-22-29/h8-22,26,30H,23-25H2,1-7H3/t26-,30-,32-/m0/s1 |
| InChIKey | BOHPPVYNPCPWRT-SWCXXNJTSA-N |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.87 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|