C30H46O4S — CID 142936166
tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]acetate;tert-butyl-methyl-diphenyl-λ4-sulfane (PubChem CID 142936166) has the molecular formula C30H46O4S and a molecular weight of 502.76 g/mol. Its IUPAC name is tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]acetate;tert-butyl-methyl-diphenyl-λ4-sulfane.
| Compound Name | tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]acetate;tert-butyl-methyl-diphenyl-λ4-sulfane |
|---|---|
| PubChem CID | 142936166 |
| Molecular Formula | C30H46O4S |
| Molecular Weight | 502.76 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]acetate;tert-butyl-methyl-diphenyl-λ4-sulfane |
| SMILES | CC(C)(C)OC(=O)COCC1CCCC(O)C1.CC(C)(C)S(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H22S.C13H24O4/c1-17(2,3)18(4,15-11-7-5-8-12-15)16-13-9-6-10-14-16;1-13(2,3)17-12(15)9-16-8-10-5-4-6-11(14)7-10/h5-14H,1-4H3;10-11,14H,4-9H2,1-3H3 |
| InChIKey | KLIIMINHPDZFFA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.76 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |