C18H24O3S — CID 12013335
[(3R,5R)-5-phenylsulfanyl-1-oxaspiro[5.5]undecan-3-yl] acetate (PubChem CID 12013335) has the molecular formula C18H24O3S and a molecular weight of 320.45 g/mol. Its IUPAC name is [(3R,5R)-5-phenylsulfanyl-1-oxaspiro[5.5]undecan-3-yl] acetate.
| Compound Name | [(3R,5R)-5-phenylsulfanyl-1-oxaspiro[5.5]undecan-3-yl] acetate |
|---|---|
| PubChem CID | 12013335 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [(3R,5R)-5-phenylsulfanyl-1-oxaspiro[5.5]undecan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1COC2(CCCCC2)[C@H](Sc2ccccc2)C1 |
| InChI | InChI=1S/C18H24O3S/c1-14(19)21-15-12-17(22-16-8-4-2-5-9-16)18(20-13-15)10-6-3-7-11-18/h2,4-5,8-9,15,17H,3,6-7,10-13H2,1H3/t15-,17-/m1/s1 |
| InChIKey | JPOCGSAFUZLCHB-NVXWUHKLSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |