C24H32O3Si — CID 10960274
3-[(2S,3S)-2-[tert-butyl(diphenyl)silyl]oxyoxan-3-yl]propanal (PubChem CID 10960274) has the molecular formula C24H32O3Si and a molecular weight of 396.60 g/mol. Its IUPAC name is 3-[(2S,3S)-2-[tert-butyl(diphenyl)silyl]oxyoxan-3-yl]propanal.
| Compound Name | 3-[(2S,3S)-2-[tert-butyl(diphenyl)silyl]oxyoxan-3-yl]propanal |
|---|---|
| PubChem CID | 10960274 |
| Molecular Formula | C24H32O3Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 3-[(2S,3S)-2-[tert-butyl(diphenyl)silyl]oxyoxan-3-yl]propanal |
| SMILES | CC(C)(C)[Si](O[C@@H]1OCCC[C@H]1CCC=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32O3Si/c1-24(2,3)28(21-14-6-4-7-15-21,22-16-8-5-9-17-22)27-23-20(12-10-18-25)13-11-19-26-23/h4-9,14-18,20,23H,10-13,19H2,1-3H3/t20-,23+/m1/s1 |
| InChIKey | FYZHYAITIJOOHQ-OFNKIYASSA-N |
| XLogP | 4.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|