C21H37NO7 — CID 134970767
[(3S,6R)-6-amino-4,5-bis(2,2-dimethylpropanoyloxy)-2-methyloxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 134970767) has the molecular formula C21H37NO7 and a molecular weight of 415.53 g/mol. Its IUPAC name is [(3S,6R)-6-amino-4,5-bis(2,2-dimethylpropanoyloxy)-2-methyloxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,6R)-6-amino-4,5-bis(2,2-dimethylpropanoyloxy)-2-methyloxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134970767 |
| Molecular Formula | C21H37NO7 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | [(3S,6R)-6-amino-4,5-bis(2,2-dimethylpropanoyloxy)-2-methyloxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC1O[C@@H](N)C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H37NO7/c1-11-12(27-16(23)19(2,3)4)13(28-17(24)20(5,6)7)14(15(22)26-11)29-18(25)21(8,9)10/h11-15H,22H2,1-10H3/t11?,12-,13?,14?,15+/m0/s1 |
| InChIKey | OAUXSHFKORKHLF-TZZMIGRFSA-N |
| XLogP | 2.56 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|