C25H44O10Si — CID 46217494
methyl (2S,3S,4R,5R,6S)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-4-(2,2-dimethylpropanoyloxy)-5-hydroxy-3-(4-oxopentanoyloxy)oxane-2-carboxylate (PubChem CID 46217494) has the molecular formula C25H44O10Si and a molecular weight of 532.70 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R,6S)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-4-(2,2-dimethylpropanoyloxy)-5-hydroxy-3-(4-oxopentanoyloxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R,6S)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-4-(2,2-dimethylpropanoyloxy)-5-hydroxy-3-(4-oxopentanoyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 46217494 |
| Molecular Formula | C25H44O10Si |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | methyl (2S,3S,4R,5R,6S)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-4-(2,2-dimethylpropanoyloxy)-5-hydroxy-3-(4-oxopentanoyloxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](O[Si](C)(C)C(C)(C)C(C)C)[C@H](O)[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)CCC(C)=O |
| InChI | InChI=1S/C25H44O10Si/c1-14(2)25(7,8)36(10,11)35-22-17(28)18(34-23(30)24(4,5)6)19(20(33-22)21(29)31-9)32-16(27)13-12-15(3)26/h14,17-20,22,28H,12-13H2,1-11H3/t17-,18-,19+,20+,22+/m1/s1 |
| InChIKey | ZPOQDKRYXQNBIT-KOVVAJLHSA-N |
| XLogP | 3.14 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|