C26H32Cl3NO10 — CID 10930180
methyl (2R,3S,4S,5R)-5-(2,2-dimethylpropanoyloxy)-3-(4-oxopentanoyloxy)-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate (PubChem CID 10930180) has the molecular formula C26H32Cl3NO10 and a molecular weight of 624.90 g/mol. Its IUPAC name is methyl (2R,3S,4S,5R)-5-(2,2-dimethylpropanoyloxy)-3-(4-oxopentanoyloxy)-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate.
| Compound Name | methyl (2R,3S,4S,5R)-5-(2,2-dimethylpropanoyloxy)-3-(4-oxopentanoyloxy)-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 10930180 |
| Molecular Formula | C26H32Cl3NO10 |
| Molecular Weight | 624.90 g/mol |
| Exact Mass | 623.11 |
| IUPAC Name | methyl (2R,3S,4S,5R)-5-(2,2-dimethylpropanoyloxy)-3-(4-oxopentanoyloxy)-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxane-2-carboxylate |
| SMILES | [H]/N=C(/OC1O[C@@H](C(=O)OC)[C@@H](OC(=O)CCC(C)=O)[C@H](OCc2ccccc2)[C@H]1OC(=O)C(C)(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H32Cl3NO10/c1-14(31)11-12-16(32)37-18-17(36-13-15-9-7-6-8-10-15)20(39-24(34)25(2,3)4)22(38-19(18)21(33)35-5)40-23(30)26(27,28)29/h6-10,17-20,22,30H,11-13H2,1-5H3/b30-23+/t17-,18-,19+,20+,22?/m0/s1 |
| InChIKey | YSHKNJJXHPCHMU-VGSRYZNZSA-N |
| XLogP | 4.07 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.90 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|