C22H38O10 — CID 71098727
methyl (3S,4S,6R)-5-(2,2-dimethylpropanoyloxy)-6-[(3S,4R,6S)-3-hydroxy-2-(hydroxymethyl)-6-methoxy-5-methyloxan-4-yl]oxy-3,4-dimethyloxane-2-carboxylate (PubChem CID 71098727) has the molecular formula C22H38O10 and a molecular weight of 462.54 g/mol. Its IUPAC name is methyl (3S,4S,6R)-5-(2,2-dimethylpropanoyloxy)-6-[(3S,4R,6S)-3-hydroxy-2-(hydroxymethyl)-6-methoxy-5-methyloxan-4-yl]oxy-3,4-dimethyloxane-2-carboxylate.
| Compound Name | methyl (3S,4S,6R)-5-(2,2-dimethylpropanoyloxy)-6-[(3S,4R,6S)-3-hydroxy-2-(hydroxymethyl)-6-methoxy-5-methyloxan-4-yl]oxy-3,4-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 71098727 |
| Molecular Formula | C22H38O10 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | methyl (3S,4S,6R)-5-(2,2-dimethylpropanoyloxy)-6-[(3S,4R,6S)-3-hydroxy-2-(hydroxymethyl)-6-methoxy-5-methyloxan-4-yl]oxy-3,4-dimethyloxane-2-carboxylate |
| SMILES | COC(=O)C1O[C@@H](O[C@@H]2C(C)[C@@H](OC)OC(CO)[C@H]2O)C(OC(=O)C(C)(C)C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C22H38O10/c1-10-11(2)17(32-21(26)22(4,5)6)20(31-16(10)18(25)27-7)30-15-12(3)19(28-8)29-13(9-23)14(15)24/h10-17,19-20,23-24H,9H2,1-8H3/t10-,11-,12?,13?,14+,15+,16?,17?,19-,20+/m0/s1 |
| InChIKey | RIITXPKEGPSBJA-GXUXAYHQSA-N |
| XLogP | 0.86 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |