C25H35NO17 — CID 154983072
methyl 4,5,6-triacetyloxy-3-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-aminooxan-2-yl]oxyoxane-2-carboxylate (PubChem CID 154983072) has the molecular formula C25H35NO17 and a molecular weight of 621.54 g/mol. Its IUPAC name is methyl 4,5,6-triacetyloxy-3-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-aminooxan-2-yl]oxyoxane-2-carboxylate.
| Compound Name | methyl 4,5,6-triacetyloxy-3-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-aminooxan-2-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 154983072 |
| Molecular Formula | C25H35NO17 |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | methyl 4,5,6-triacetyloxy-3-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-aminooxan-2-yl]oxyoxane-2-carboxylate |
| SMILES | COC(=O)C1OC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1N |
| InChI | InChI=1S/C25H35NO17/c1-9(27)35-8-15-17(36-10(2)28)18(37-11(3)29)16(26)24(41-15)42-19-20(38-12(4)30)22(39-13(5)31)25(40-14(6)32)43-21(19)23(33)34-7/h15-22,24-25H,8,26H2,1-7H3 |
| InChIKey | OKJPGBFUXOUWAX-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 237.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|