C35H31FN2O10 — CID 86620049
[5-(4-fluoro-2-methylphenyl)-6-(4-nitrobenzoyl)oxy-4-(phenylmethoxymethyl)oxan-3-yl]methyl 4-nitrobenzoate (PubChem CID 86620049) has the molecular formula C35H31FN2O10 and a molecular weight of 658.64 g/mol. Its IUPAC name is [5-(4-fluoro-2-methylphenyl)-6-(4-nitrobenzoyl)oxy-4-(phenylmethoxymethyl)oxan-3-yl]methyl 4-nitrobenzoate.
| Compound Name | [5-(4-fluoro-2-methylphenyl)-6-(4-nitrobenzoyl)oxy-4-(phenylmethoxymethyl)oxan-3-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 86620049 |
| Molecular Formula | C35H31FN2O10 |
| Molecular Weight | 658.64 g/mol |
| Exact Mass | 658.20 |
| IUPAC Name | [5-(4-fluoro-2-methylphenyl)-6-(4-nitrobenzoyl)oxy-4-(phenylmethoxymethyl)oxan-3-yl]methyl 4-nitrobenzoate |
| SMILES | Cc1cc(F)ccc1C1C(OC(=O)c2ccc([N+](=O)[O-])cc2)OCC(COC(=O)c2ccc([N+](=O)[O-])cc2)C1COCc1ccccc1 |
| InChI | InChI=1S/C35H31FN2O10/c1-22-17-27(36)11-16-30(22)32-31(21-45-18-23-5-3-2-4-6-23)26(19-46-33(39)24-7-12-28(13-8-24)37(41)42)20-47-35(32)48-34(40)25-9-14-29(15-10-25)38(43)44/h2-17,26,31-32,35H,18-21H2,1H3 |
| InChIKey | VKGHZSQYDBRBQZ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.64 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|