C20H21FN2O8 — CID 122232233
(2S,3R,4R,5R)-2-fluoro-3-methoxy-4-[(4-nitrophenyl)methoxy]-5-[(4-nitrophenyl)methoxymethyl]oxolane (PubChem CID 122232233) has the molecular formula C20H21FN2O8 and a molecular weight of 436.39 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-fluoro-3-methoxy-4-[(4-nitrophenyl)methoxy]-5-[(4-nitrophenyl)methoxymethyl]oxolane.
| Compound Name | (2S,3R,4R,5R)-2-fluoro-3-methoxy-4-[(4-nitrophenyl)methoxy]-5-[(4-nitrophenyl)methoxymethyl]oxolane |
|---|---|
| PubChem CID | 122232233 |
| Molecular Formula | C20H21FN2O8 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (2S,3R,4R,5R)-2-fluoro-3-methoxy-4-[(4-nitrophenyl)methoxy]-5-[(4-nitrophenyl)methoxymethyl]oxolane |
| SMILES | CO[C@@H]1[C@H](OCc2ccc([N+](=O)[O-])cc2)[C@@H](COCc2ccc([N+](=O)[O-])cc2)O[C@H]1F |
| InChI | InChI=1S/C20H21FN2O8/c1-28-19-18(30-11-14-4-8-16(9-5-14)23(26)27)17(31-20(19)21)12-29-10-13-2-6-15(7-3-13)22(24)25/h2-9,17-20H,10-12H2,1H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | JBTDBLLXWZOAJD-UAFMIMERSA-N |
| XLogP | 3.31 |
| TPSA | 123.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|