C49H50O7 — CID 11411649
[3-phenylmethoxy-4-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]phenyl]methanol (PubChem CID 11411649) has the molecular formula C49H50O7 and a molecular weight of 750.93 g/mol. Its IUPAC name is [3-phenylmethoxy-4-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]phenyl]methanol.
| Compound Name | [3-phenylmethoxy-4-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 11411649 |
| Molecular Formula | C49H50O7 |
| Molecular Weight | 750.93 g/mol |
| Exact Mass | 750.36 |
| IUPAC Name | [3-phenylmethoxy-4-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]phenyl]methanol |
| SMILES | OCc1ccc(C[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C49H50O7/c50-30-42-26-27-43(44(28-42)52-32-38-18-8-2-9-19-38)29-45-47(53-33-39-20-10-3-11-21-39)49(55-35-41-24-14-5-15-25-41)48(54-34-40-22-12-4-13-23-40)46(56-45)36-51-31-37-16-6-1-7-17-37/h1-28,45-50H,29-36H2/t45-,46+,47-,48+,49+/m0/s1 |
| InChIKey | UJCCJTMWIAEQGJ-DBTIBLCQSA-N |
| XLogP | 9.04 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.93 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |