C53H55NO9 — CID 101171768
(2R)-2-acetamido-3-[3-phenylmethoxy-4-[[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]phenyl]propanoic acid (PubChem CID 101171768) has the molecular formula C53H55NO9 and a molecular weight of 850.02 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[3-phenylmethoxy-4-[[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]phenyl]propanoic acid.
| Compound Name | (2R)-2-acetamido-3-[3-phenylmethoxy-4-[[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 101171768 |
| Molecular Formula | C53H55NO9 |
| Molecular Weight | 850.02 g/mol |
| Exact Mass | 849.39 |
| IUPAC Name | (2R)-2-acetamido-3-[3-phenylmethoxy-4-[[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]phenyl]propanoic acid |
| SMILES | CC(=O)N[C@H](Cc1ccc(C[C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)c(OCc2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C53H55NO9/c1-38(55)54-46(53(56)57)29-44-27-28-45(47(30-44)59-33-40-19-9-3-10-20-40)31-48-50(60-34-41-21-11-4-12-22-41)52(62-36-43-25-15-6-16-26-43)51(61-35-42-23-13-5-14-24-42)49(63-48)37-58-32-39-17-7-2-8-18-39/h2-28,30,46,48-52H,29,31-37H2,1H3,(H,54,55)(H,56,57)/t46-,48-,49-,50+,51-,52-/m1/s1 |
| InChIKey | CWJBNFKFQNDPKC-AUGZXJRESA-N |
| XLogP | 8.68 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.02 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |