C19H24Cl2N2O11 — CID 101047699
methyl (2S,3S,4S,5R,6S)-6-[4-[bis(2-chloroethyl)carbamoyloxymethyl]-2-nitrophenoxy]-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 101047699) has the molecular formula C19H24Cl2N2O11 and a molecular weight of 527.31 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-6-[4-[bis(2-chloroethyl)carbamoyloxymethyl]-2-nitrophenoxy]-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-6-[4-[bis(2-chloroethyl)carbamoyloxymethyl]-2-nitrophenoxy]-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 101047699 |
| Molecular Formula | C19H24Cl2N2O11 |
| Molecular Weight | 527.31 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-6-[4-[bis(2-chloroethyl)carbamoyloxymethyl]-2-nitrophenoxy]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(COC(=O)N(CCCl)CCCl)cc2[N+](=O)[O-])[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H24Cl2N2O11/c1-31-17(27)16-14(25)13(24)15(26)18(34-16)33-12-3-2-10(8-11(12)23(29)30)9-32-19(28)22(6-4-20)7-5-21/h2-3,8,13-16,18,24-26H,4-7,9H2,1H3/t13-,14-,15+,16-,18+/m0/s1 |
| InChIKey | PJXNLERSPUQTOV-RNGZQALNSA-N |
| XLogP | 0.37 |
| TPSA | 178.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|