C17H21NO11 — CID 164543026
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-(2-methylpropanoyloxymethyl)-2-nitrophenoxy]oxane-2-carboxylic acid (PubChem CID 164543026) has the molecular formula C17H21NO11 and a molecular weight of 415.35 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-(2-methylpropanoyloxymethyl)-2-nitrophenoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-(2-methylpropanoyloxymethyl)-2-nitrophenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 164543026 |
| Molecular Formula | C17H21NO11 |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-(2-methylpropanoyloxymethyl)-2-nitrophenoxy]oxane-2-carboxylic acid |
| SMILES | CC(C)C(=O)OCc1ccc(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H21NO11/c1-7(2)16(24)27-6-8-3-4-10(9(5-8)18(25)26)28-17-13(21)11(19)12(20)14(29-17)15(22)23/h3-5,7,11-14,17,19-21H,6H2,1-2H3,(H,22,23)/t11-,12-,13+,14-,17+/m0/s1 |
| InChIKey | BIDWSPZKQIYUQV-JEJJNBGPSA-N |
| XLogP | -0.44 |
| TPSA | 185.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|