C13H13F3N2O9 — CID 68814317
(2S,3S,4S,5R)-6-[2-amino-5-nitro-4-(trifluoromethyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 68814317) has the molecular formula C13H13F3N2O9 and a molecular weight of 398.25 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-[2-amino-5-nitro-4-(trifluoromethyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-6-[2-amino-5-nitro-4-(trifluoromethyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 68814317 |
| Molecular Formula | C13H13F3N2O9 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | (2S,3S,4S,5R)-6-[2-amino-5-nitro-4-(trifluoromethyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | Nc1cc(C(F)(F)F)c([N+](=O)[O-])cc1OC1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H13F3N2O9/c14-13(15,16)3-1-4(17)6(2-5(3)18(24)25)26-12-9(21)7(19)8(20)10(27-12)11(22)23/h1-2,7-10,12,19-21H,17H2,(H,22,23)/t7-,8-,9+,10-,12?/m0/s1 |
| InChIKey | HLPWBGUTFYMWSF-SDQGTYQYSA-N |
| XLogP | -0.53 |
| TPSA | 185.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|