C23H36N4O7 — CID 122631656
[4-[(3S,4S)-6-acetyl-3,4,5-trimethyloxan-2-yl]oxy-3-nitrophenyl]methyl N-[(deuterioamino)methyl]-N-[2-(dimethylamino)ethyl]carbamate (PubChem CID 122631656) has the molecular formula C23H36N4O7 and a molecular weight of 481.57 g/mol. Its IUPAC name is [4-[(3S,4S)-6-acetyl-3,4,5-trimethyloxan-2-yl]oxy-3-nitrophenyl]methyl N-[(deuterioamino)methyl]-N-[2-(dimethylamino)ethyl]carbamate.
| Compound Name | [4-[(3S,4S)-6-acetyl-3,4,5-trimethyloxan-2-yl]oxy-3-nitrophenyl]methyl N-[(deuterioamino)methyl]-N-[2-(dimethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 122631656 |
| Molecular Formula | C23H36N4O7 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | [4-[(3S,4S)-6-acetyl-3,4,5-trimethyloxan-2-yl]oxy-3-nitrophenyl]methyl N-[(deuterioamino)methyl]-N-[2-(dimethylamino)ethyl]carbamate |
| SMILES | [2H]NCN(CCN(C)C)C(=O)OCc1ccc(OC2OC(C(C)=O)C(C)[C@H](C)[C@@H]2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H36N4O7/c1-14-15(2)21(17(4)28)34-22(16(14)3)33-20-8-7-18(11-19(20)27(30)31)12-32-23(29)26(13-24)10-9-25(5)6/h7-8,11,14-16,21-22H,9-10,12-13,24H2,1-6H3/t14-,15?,16-,21?,22?/m0/s1/i/hD |
| InChIKey | FPYJOPMQHQLITE-UTWQZFRLSA-N |
| XLogP | 2.61 |
| TPSA | 137.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|