C26H28O11 — CID 123972319
[2-(3,4-dihydroxyphenyl)-3-(2,2-dimethylpropanoylperoxy)-5-methoxy-4-oxochromen-7-yl] 2,2-dimethylpropaneperoxoate (PubChem CID 123972319) has the molecular formula C26H28O11 and a molecular weight of 516.50 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-3-(2,2-dimethylpropanoylperoxy)-5-methoxy-4-oxochromen-7-yl] 2,2-dimethylpropaneperoxoate.
| Compound Name | [2-(3,4-dihydroxyphenyl)-3-(2,2-dimethylpropanoylperoxy)-5-methoxy-4-oxochromen-7-yl] 2,2-dimethylpropaneperoxoate |
|---|---|
| PubChem CID | 123972319 |
| Molecular Formula | C26H28O11 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-3-(2,2-dimethylpropanoylperoxy)-5-methoxy-4-oxochromen-7-yl] 2,2-dimethylpropaneperoxoate |
| SMILES | COc1cc(OOC(=O)C(C)(C)C)cc2oc(-c3ccc(O)c(O)c3)c(OOC(=O)C(C)(C)C)c(=O)c12 |
| InChI | InChI=1S/C26H28O11/c1-25(2,3)23(30)36-34-14-11-17(32-7)19-18(12-14)33-21(13-8-9-15(27)16(28)10-13)22(20(19)29)35-37-24(31)26(4,5)6/h8-12,27-28H,1-7H3 |
| InChIKey | GFQOOCJAKHKDOU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 150.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|