C43H34O7 — CID 18703867
6-benzyl-2-(3,4-dihydroxyphenyl)-3,5,7-tris(phenylmethoxy)chromen-4-one (PubChem CID 18703867) has the molecular formula C43H34O7 and a molecular weight of 662.74 g/mol. Its IUPAC name is 6-benzyl-2-(3,4-dihydroxyphenyl)-3,5,7-tris(phenylmethoxy)chromen-4-one.
| Compound Name | 6-benzyl-2-(3,4-dihydroxyphenyl)-3,5,7-tris(phenylmethoxy)chromen-4-one |
|---|---|
| PubChem CID | 18703867 |
| Molecular Formula | C43H34O7 |
| Molecular Weight | 662.74 g/mol |
| Exact Mass | 662.23 |
| IUPAC Name | 6-benzyl-2-(3,4-dihydroxyphenyl)-3,5,7-tris(phenylmethoxy)chromen-4-one |
| SMILES | O=c1c(OCc2ccccc2)c(-c2ccc(O)c(O)c2)oc2cc(OCc3ccccc3)c(Cc3ccccc3)c(OCc3ccccc3)c12 |
| InChI | InChI=1S/C43H34O7/c44-35-22-21-33(24-36(35)45)41-43(49-28-32-19-11-4-12-20-32)40(46)39-38(50-41)25-37(47-26-30-15-7-2-8-16-30)34(23-29-13-5-1-6-14-29)42(39)48-27-31-17-9-3-10-18-31/h1-22,24-25,44-45H,23,26-28H2 |
| InChIKey | HJSTVYGUVFDRRE-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.74 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|