C36H28O10 — CID 140561044
3-benzylperoxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(phenylmethoxy)chromen-4-one (PubChem CID 140561044) has the molecular formula C36H28O10 and a molecular weight of 620.61 g/mol. Its IUPAC name is 3-benzylperoxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(phenylmethoxy)chromen-4-one.
| Compound Name | 3-benzylperoxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(phenylmethoxy)chromen-4-one |
|---|---|
| PubChem CID | 140561044 |
| Molecular Formula | C36H28O10 |
| Molecular Weight | 620.61 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | 3-benzylperoxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(phenylmethoxy)chromen-4-one |
| SMILES | O=c1c(OOCc2ccccc2)c(-c2ccc(O)c(O)c2)oc2c(OCc3ccccc3)c(O)c(OCc3ccccc3)c(O)c12 |
| InChI | InChI=1S/C36H28O10/c37-26-17-16-25(18-27(26)38)32-36(46-44-21-24-14-8-3-9-15-24)30(40)28-29(39)34(42-19-22-10-4-1-5-11-22)31(41)35(33(28)45-32)43-20-23-12-6-2-7-13-23/h1-18,37-39,41H,19-21H2 |
| InChIKey | ZRERAGOQFKCVKH-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|