C17H14O10 — CID 91474028
2-(3,4-dihydroxyphenyl)-3-ethoxy-5,7-dihydroperoxy-6-hydroxychromen-4-one (PubChem CID 91474028) has the molecular formula C17H14O10 and a molecular weight of 378.29 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3-ethoxy-5,7-dihydroperoxy-6-hydroxychromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3-ethoxy-5,7-dihydroperoxy-6-hydroxychromen-4-one |
|---|---|
| PubChem CID | 91474028 |
| Molecular Formula | C17H14O10 |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3-ethoxy-5,7-dihydroperoxy-6-hydroxychromen-4-one |
| SMILES | CCOc1c(-c2ccc(O)c(O)c2)oc2cc(OO)c(O)c(OO)c2c1=O |
| InChI | InChI=1S/C17H14O10/c1-2-24-17-14(21)12-10(6-11(26-22)13(20)16(12)27-23)25-15(17)7-3-4-8(18)9(19)5-7/h3-6,18-20,22-23H,2H2,1H3 |
| InChIKey | RQQAEVRAKHVOBS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 159.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|