C21H26O5Si2 — CID 528412
3-hydroxy-2-phenyl-5,7-bis(trimethylsilyloxy)chromen-4-one (PubChem CID 528412) has the molecular formula C21H26O5Si2 and a molecular weight of 414.61 g/mol. Its IUPAC name is 3-hydroxy-2-phenyl-5,7-bis(trimethylsilyloxy)chromen-4-one.
| Compound Name | 3-hydroxy-2-phenyl-5,7-bis(trimethylsilyloxy)chromen-4-one |
|---|---|
| PubChem CID | 528412 |
| Molecular Formula | C21H26O5Si2 |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 3-hydroxy-2-phenyl-5,7-bis(trimethylsilyloxy)chromen-4-one |
| SMILES | C[Si](C)(C)Oc1cc(O[Si](C)(C)C)c2c(=O)c(O)c(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C21H26O5Si2/c1-27(2,3)25-15-12-16-18(17(13-15)26-28(4,5)6)19(22)20(23)21(24-16)14-10-8-7-9-11-14/h7-13,23H,1-6H3 |
| InChIKey | XEBOPEAAOAXVHM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|