About 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one
8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one (PubChem CID 4304691) has the molecular formula C17H10O4
and a molecular weight of 278.26 g/mol. Its IUPAC name is 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one.
Molecular Properties
| Compound Name | 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one |
| PubChem CID | 4304691 |
| Molecular Formula | C17H10O4 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one |
| SMILES | O=c1c(O)c(-c2ccccc2)oc2ccc3occc3c12 |
| InChI | InChI=1S/C17H10O4/c18-15-14-11-8-9-20-12(11)6-7-13(14)21-17(16(15)19)10-4-2-1-3-5-10/h1-9,19H |
| InChIKey | RFTCASQIXQHXFX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one?
The IUPAC name of 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one (CID 4304691) is 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one.
What is the SMILES notation for 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one?
The canonical SMILES for 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one is O=c1c(O)c(-c2ccccc2)oc2ccc3occc3c12.
What is the InChIKey of 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one?
The InChIKey is RFTCASQIXQHXFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10O4/c18-15-14-11-8-9-20-12(11)6-7-13(14)21-17(16(15)19)10-4-2-1-3-5-10/h1-9,19H.
What are the key properties of 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one?
8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one has a molecular weight of 278.26 g/mol, XLogP of 3.91, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-7-phenylfuro[3,2-f]chromen-9-one is sourced from PubChem (CID 4304691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).